EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO4 |
| Net Charge | -2 |
| Average Mass | 157.125 |
| Monoisotopic Mass | 157.03860 |
| SMILES | C=C(C[C@H](N)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11)/p-2/t4-/m0/s1 |
| InChIKey | RCCMXKJGURLWPB-BYPYZUCNSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylene-L-glutamate(2−) (CHEBI:17299) has functional parent L-glutamate(2−) (CHEBI:29988) |
| 4-methylene-L-glutamate(2−) (CHEBI:17299) is a α-amino-acid anion (CHEBI:33558) |
| 4-methylene-L-glutamate(2−) (CHEBI:17299) is conjugate base of 4-methylene-L-glutamate(1−) (CHEBI:58733) |
| Incoming Relation(s) |
| 4-methylene-L-glutamate(1−) (CHEBI:58733) is conjugate acid of 4-methylene-L-glutamate(2−) (CHEBI:17299) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-methylidenepentanedioate |
| Synonym | Source |
|---|---|
| (2S)-2-amino-4-methylenepentanedioate | IUPAC |