EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO4 |
| Net Charge | 0 |
| Average Mass | 159.141 |
| Monoisotopic Mass | 159.05316 |
| SMILES | C=C(C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | RCCMXKJGURLWPB-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is a 4-methyleneglutamic acid (CHEBI:48029) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is conjugate acid of 4-methylene-L-glutamate(1−) (CHEBI:58733) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is enantiomer of 4-methylene-D-glutamic acid (CHEBI:48032) |
| Incoming Relation(s) |
| 4-methylene-L-glutamate(1−) (CHEBI:58733) is conjugate base of 4-methylene-L-glutamic acid (CHEBI:48031) |
| 4-methylene-D-glutamic acid (CHEBI:48032) is enantiomer of 4-methylene-L-glutamic acid (CHEBI:48031) |
| IUPAC Names |
|---|
| (2S)-2-amino-4-methylidenepentanedioic acid |
| 4-methylidene-L-glutamic acid |
| Synonym | Source |
|---|---|
| 4-Methylene-L-glutamate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00651 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724834 | Beilstein |
| CAS:16804-57-2 | ChemIDplus |