EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5852 - ibogaine
| Formula | C20H26N2O |
| Net Charge | 0 |
| Average Mass | 310.441 |
| Monoisotopic Mass | 310.20451 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccc(OC)cc45)[C@]3([H])C1)C2 |
| InChI | InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
| InChIKey | HSIBGVUMFOSJPD-CFDPKNGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. inhibitor A substance that diminishes the rate of a chemical reaction. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibogaine (CHEBI:5852) has functional parent ibogamine (CHEBI:5853) |
| ibogaine (CHEBI:5852) has role hallucinogen (CHEBI:35499) |
| ibogaine (CHEBI:5852) has role inhibitor (CHEBI:35222) |
| ibogaine (CHEBI:5852) has role oneirogen (CHEBI:146270) |
| ibogaine (CHEBI:5852) has role plant metabolite (CHEBI:76924) |
| ibogaine (CHEBI:5852) is a aromatic ether (CHEBI:35618) |
| ibogaine (CHEBI:5852) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| ibogaine (CHEBI:5852) is a organic heteropentacyclic compound (CHEBI:38164) |
| ibogaine (CHEBI:5852) is conjugate base of ibogaine(1+) (CHEBI:146259) |
| Incoming Relation(s) |
| noribogaine (CHEBI:146264) has functional parent ibogaine (CHEBI:5852) |
| ibogaine(1+) (CHEBI:146259) is conjugate acid of ibogaine (CHEBI:5852) |
| IUPAC Name |
|---|
| (18R)-12-methoxyibogamine |
| Synonyms | Source |
|---|---|
| 12-methoxyibogamine | ChemIDplus |
| (−)-ibogaine | ChemIDplus |
| Ibogaine | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Endabuse | ChemIDplus |
| Citations |
|---|