EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5852 - ibogaine
| Formula | C20H26N2O |
| Net Charge | 0 |
| Average Mass | 310.441 |
| Monoisotopic Mass | 310.20451 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccc(OC)cc45)[C@]3([H])C1)C2 |
| InChI | InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
| InChIKey | HSIBGVUMFOSJPD-CFDPKNGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | inhibitor A substance that diminishes the rate of a chemical reaction. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibogaine (CHEBI:5852) has functional parent ibogamine (CHEBI:5853) |
| ibogaine (CHEBI:5852) has role hallucinogen (CHEBI:35499) |
| ibogaine (CHEBI:5852) has role inhibitor (CHEBI:35222) |
| ibogaine (CHEBI:5852) has role oneirogen (CHEBI:146270) |
| ibogaine (CHEBI:5852) has role plant metabolite (CHEBI:76924) |
| ibogaine (CHEBI:5852) is a aromatic ether (CHEBI:35618) |
| ibogaine (CHEBI:5852) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| ibogaine (CHEBI:5852) is a organic heteropentacyclic compound (CHEBI:38164) |
| ibogaine (CHEBI:5852) is conjugate base of ibogaine(1+) (CHEBI:146259) |
| Incoming Relation(s) |
| noribogaine (CHEBI:146264) has functional parent ibogaine (CHEBI:5852) |
| ibogaine(1+) (CHEBI:146259) is conjugate acid of ibogaine (CHEBI:5852) |
| IUPAC Name |
|---|
| (18R)-12-methoxyibogamine |
| Synonyms | Source |
|---|---|
| 12-methoxyibogamine | ChemIDplus |
| (−)-ibogaine | ChemIDplus |
| Ibogaine | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Endabuse | ChemIDplus |
| Citations |
|---|