EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2 |
| Net Charge | 0 |
| Average Mass | 280.415 |
| Monoisotopic Mass | 280.19395 |
| SMILES | [H][C@@]12C[C@H](CC)[C@@]3([H])[C@@H](C1)c1nc4ccccc4c1CC[N@@]3C2 |
| InChI | InChI=1S/C19H24N2/c1-2-13-9-12-10-16-18-15(7-8-21(11-12)19(13)16)14-5-3-4-6-17(14)20-18/h3-6,12-13,16,19-20H,2,7-11H2,1H3/t12-,13+,16+,19+/m1/s1 |
| InChIKey | LRLCVRYKAFDXKU-YGOSVGOTSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ervatamia hainanensis (IPNI:78925-1) | rhizome (BTO:0001181) | PubMed (17879729) | |
| Stemmadenia galeottiana (IPNI:81804-1) | wood (BTO:0005516) | DOI (/10.1007/BF01181911) | |
| Tabernaemontana alba (IPNI:81985-1) | bark (BTO:0001301) | PubMed (31095891) | Isolated from root bark. |
| Tabernaemontana australis (IPNI:315554-2) | - | PubMed (15911323) | Isolated from stalk. |
| Tabernaemontana catharinensis (ncbitaxon:403124) | stem (BTO:0001300) | PubMed (30599414) | |
| Tabernaemontana hystrix (ncbitaxon:761074) | - | PubMed (18797794) | |
| Tabernaemontana johnstonii (IPNI:82167-1) | bark (BTO:0001301) | PubMed (621649) | Isolated from stem bark. |
| Tabernanthe iboga (ncbitaxon:141617) | - | DOI (/10.1021/ja01534a036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibogamine (CHEBI:5853) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| ibogamine (CHEBI:5853) has role oneirogen (CHEBI:146270) |
| ibogamine (CHEBI:5853) has role plant metabolite (CHEBI:76924) |
| ibogamine (CHEBI:5853) is a indole alkaloid fundamental parent (CHEBI:38482) |
| ibogamine (CHEBI:5853) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| ibogamine (CHEBI:5853) is a organic heteropentacyclic compound (CHEBI:38164) |
| ibogamine (CHEBI:5853) is a tertiary amino compound (CHEBI:50996) |
| ibogamine (CHEBI:5853) is conjugate base of ibogamine(1+) (CHEBI:146257) |
| Incoming Relation(s) |
| ibogaine (CHEBI:5852) has functional parent ibogamine (CHEBI:5853) |
| ibogamine(1+) (CHEBI:146257) is conjugate acid of ibogamine (CHEBI:5853) |
| IUPAC Name |
|---|
| ibogamine |
| Synonyms | Source |
|---|---|
| (−)-ibogamine | ChEBI |
| ibogamine | KEGG COMPOUND |
| Citations |
|---|