EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.18886 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccc(O)cc45)[C@]3([H])C1)C2 |
| InChI | InChI=1S/C19H24N2O/c1-2-12-7-11-8-16-18-14(5-6-21(10-11)19(12)16)15-9-13(22)3-4-17(15)20-18/h3-4,9,11-12,16,19-20,22H,2,5-8,10H2,1H3/t11-,12+,16+,19+/m1/s1 |
| InChIKey | RAUCDOKTMDOIPF-RYRUWHOVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| noribogaine (CHEBI:146264) has functional parent ibogaine (CHEBI:5852) |
| noribogaine (CHEBI:146264) has role NMDA receptor antagonist (CHEBI:60643) |
| noribogaine (CHEBI:146264) has role psychotropic drug (CHEBI:35471) |
| noribogaine (CHEBI:146264) has role serotonin uptake inhibitor (CHEBI:50949) |
| noribogaine (CHEBI:146264) has role κ-opioid receptor agonist (CHEBI:59282) |
| noribogaine (CHEBI:146264) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| noribogaine (CHEBI:146264) is a organic heteropentacyclic compound (CHEBI:38164) |
| noribogaine (CHEBI:146264) is a secondary amino compound (CHEBI:50995) |
| noribogaine (CHEBI:146264) is a tertiary amino compound (CHEBI:50996) |
| noribogaine (CHEBI:146264) is conjugate base of noribogaine(1+) (CHEBI:146258) |
| Incoming Relation(s) |
| noribogaine(1+) (CHEBI:146258) is conjugate acid of noribogaine (CHEBI:146264) |
| IUPAC Name |
|---|
| (18R)-ibogamine-12-ol |
| Synonyms | Source |
|---|---|
| 12-hydroxyibogamine | ChemIDplus |
| O-desmethylibogaine | ChEBI |
| O-noribogaine | ChemIDplus |
| ibogamin-12-ol | ChemIDplus |
| O-demethylibogaine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Noribogaine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:481-88-9 | ChemIDplus |
| Citations |
|---|