EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O16S |
| Net Charge | 0 |
| Average Mass | 558.426 |
| Monoisotopic Mass | 558.03156 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc23)[C@H](O)[C@@H](OS(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C21H18O16S/c22-7-2-1-6(3-8(7)23)12-5-10(25)13-9(24)4-11(26)16(17(13)34-12)35-21-15(28)18(37-38(31,32)33)14(27)19(36-21)20(29)30/h1-5,14-15,18-19,21-24,26-28H,(H,29,30)(H,31,32,33)/t14-,15+,18-,19-,21+/m0/s1 |
| InChIKey | ZRZNGKWFMIBYEF-DLSLMLROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Theobroma grandiflorum (ncbitaxon:108881) | seed (BTO:0001226) | PubMed (14640528) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theograndin II (CHEBI:66218) has functional parent hypolaetin (CHEBI:5837) |
| theograndin II (CHEBI:66218) has role antioxidant (CHEBI:22586) |
| theograndin II (CHEBI:66218) has role plant metabolite (CHEBI:76924) |
| theograndin II (CHEBI:66218) is a glucosiduronic acid (CHEBI:24302) |
| theograndin II (CHEBI:66218) is a glycosyloxyflavone (CHEBI:50018) |
| theograndin II (CHEBI:66218) is a monosaccharide sulfate (CHEBI:24589) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-8-yl 3-O-sulfo-β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 5,7,3',4'-tetrahydroxyflavone-8-O-β-D-glucopyranoside-3''-O-sulfate | ChEBI |
| hypolaetin-8-O-β-D-glucuronopyranoside-3''-O-sulfate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9828545 | Reaxys |
| Citations |
|---|