EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H17NO13S)n.H2O |
| Net Charge | -2 |
| Average Mass | 433.344 |
| Monoisotopic Mass | 433.05372 |
| SMILES | [H]O[C@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1NS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H21NO14S/c14-1-2-8(4(15)3(11(21)25-2)13-28(22,23)24)26-12-7(18)5(16)6(17)9(27-12)10(19)20/h2-9,11-18,21H,1H2,(H,19,20)(H,22,23,24)/p-2/t2-,3-,4-,5+,6+,7-,8-,9+,11+,12-/m1/s1 |
| InChIKey | KNKWELGWBDSUOG-OYQIKJLFSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is a carbohydrate acid derivative anion (CHEBI:63551) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is a carboxylic acid anion (CHEBI:29067) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is a heparosan D-glucuronic acid zwitterion (CHEBI:85307) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is a organic sulfamate oxoanion (CHEBI:61660) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is conjugate base of heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) |
| Incoming Relation(s) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is conjugate acid of heparosan-N-sulfate D-glucuronate (CHEBI:58287) |
| UniProt Name | Source |
|---|---|
| heparosan-N-sulfate D-glucuronate | UniProt |