EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H19NO10)n.H2O |
| Net Charge | 0 |
| Average Mass | 355.296 |
| Monoisotopic Mass | 355.11146 |
| SMILES | [H]O[C@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1[NH3+] |
| InChI | InChI=1S/C12H21NO11/c13-3-4(15)8(2(1-14)22-11(3)21)23-12-7(18)5(16)6(17)9(24-12)10(19)20/h2-9,11-12,14-18,21H,1,13H2,(H,19,20)/t2-,3-,4-,5+,6+,7-,8-,9+,11+,12-/m1/s1 |
| InChIKey | ZBRQSBGQEWKGJC-OYQIKJLFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparosan D-glucuronic acid zwitterion (CHEBI:85307) is a zwitterion (CHEBI:27369) |
| heparosan D-glucuronic acid zwitterion (CHEBI:85307) is tautomer of heparosan D-glucuronic acid (CHEBI:85801) |
| Incoming Relation(s) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is a heparosan D-glucuronic acid zwitterion (CHEBI:85307) |
| heparosan D-glucuronic acid (CHEBI:85801) is tautomer of heparosan D-glucuronic acid zwitterion (CHEBI:85307) |
| UniProt Name | Source |
|---|---|
| heparosan D-glucuronate | UniProt |