EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H19NO13S)n.H2O |
| Net Charge | 0 |
| Average Mass | 435.360 |
| Monoisotopic Mass | 435.06828 |
| SMILES | [H]O[C@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1NS(=O)(=O)O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1a_1-5_2*NSO/3=O/3=O][a2122A-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H21NO14S/c14-1-2-8(4(15)3(11(21)25-2)13-28(22,23)24)26-12-7(18)5(16)6(17)9(27-12)10(19)20/h2-9,11-18,21H,1H2,(H,19,20)(H,22,23,24)/t2-,3-,4-,5+,6+,7-,8-,9+,11+,12-/m1/s1 |
| InChIKey | KNKWELGWBDSUOG-OYQIKJLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) has role mouse metabolite (CHEBI:75771) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is a D-glucopyranuronic acid (CHEBI:47952) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is a glucuronic acids (CHEBI:33886) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is a heparan sulfates (CHEBI:35721) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is conjugate acid of heparosan-N-sulfate D-glucuronate (CHEBI:58287) |
| Incoming Relation(s) |
| heparosan-N-sulfate D-glucuronate (CHEBI:58287) is conjugate base of heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) |
| IUPAC Name |
|---|
| poly[(1→4)-(β-D-glucopyranosyluronic acid)-(1→4)-2-deoxy-2-sulfoamino-α-D-glucopyranosyl] |
| Synonyms | Source |
|---|---|
| [4)-β-D-GlcA-(1→4)-α-D-GlcNS-(1→]n | ChEBI |
| [4)-β-D-GlcpA-(1→4)-α-D-GlcpNS-(1→]n | ChEBI |
| Heparosan-N-sulfate D-glucuronate | KEGG COMPOUND |
| poly[(1→4)-β-D-glucuronosyl-(1→4)-N-sulfo-α-D-glucosaminyl] | IUBMB |
| Manual Xrefs | Databases |
|---|---|
| C04196 | KEGG COMPOUND |
| Citations |
|---|