EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O11P2 |
| Net Charge | -2 |
| Average Mass | 441.186 |
| Monoisotopic Mass | 441.00978 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N5O11P2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-28(22,23)26-27(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18)/p-2/t3-,5-,6-,9-/m1/s1 |
| InChIKey | QGWNDRXFNXRZMB-UUOKFMHZSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP(2−) (CHEBI:65180) is a organophosphate oxoanion (CHEBI:58945) |
| GDP(2−) (CHEBI:65180) is conjugate acid of GDP(3−) (CHEBI:58189) |
| GDP(2−) (CHEBI:65180) is conjugate base of GDP (CHEBI:17552) |
| Incoming Relation(s) |
| GDP (CHEBI:17552) is conjugate acid of GDP(2−) (CHEBI:65180) |
| GDP(3−) (CHEBI:58189) is conjugate base of GDP(2−) (CHEBI:65180) |
| IUPAC Name |
|---|
| 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine |
| Synonyms | Source |
|---|---|
| guanosine 5'-diphosphate(2−) | ChEBI |
| guanosine 5'-diphosphate dianion | ChEBI |
| GDP dianion | ChEBI |