EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S2 |
| Net Charge | 0 |
| Average Mass | 268.360 |
| Monoisotopic Mass | 268.05515 |
| SMILES | [NH3+]C(CCSSCCC([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
| InChIKey | ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocystine zwitterion (CHEBI:58163) has role human metabolite (CHEBI:77746) |
| homocystine zwitterion (CHEBI:58163) is a amino-acid zwitterion (CHEBI:35238) |
| homocystine zwitterion (CHEBI:58163) is tautomer of homocystine (CHEBI:17485) |
| Incoming Relation(s) |
| L,L-homocystine zwitterion (CHEBI:140613) is a homocystine zwitterion (CHEBI:58163) |
| homocystine (CHEBI:17485) is tautomer of homocystine zwitterion (CHEBI:58163) |
| IUPAC Name |
|---|
| 4,4'-disulfanediylbis(2-azaniumylbutanoate) |
| Synonyms | Source |
|---|---|
| 4,4'-disulfanediylbis(2-ammoniobutanoate) | IUPAC |
| homocystine dizwitterion | ChEBI |