EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17O9 |
| Net Charge | -1 |
| Average Mass | 353.303 |
| Monoisotopic Mass | 353.08781 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)[O-])C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/p-1/b4-2+/t11-,12-,14-,16+/m1/s1 |
| InChIKey | CWVRJTMFETXNAD-JUHZACGLSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorogenate (CHEBI:57644) has functional parent (−)-quinate (CHEBI:29751) |
| chlorogenate (CHEBI:57644) has role plant metabolite (CHEBI:76924) |
| chlorogenate (CHEBI:57644) is a monocarboxylic acid anion (CHEBI:35757) |
| chlorogenate (CHEBI:57644) is conjugate base of chlorogenic acid (CHEBI:16112) |
| Incoming Relation(s) |
| chlorogenic acid (CHEBI:16112) is conjugate acid of chlorogenate (CHEBI:57644) |
| IUPAC Name |
|---|
| (1S,3R,4R,5R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexanecarboxylate |
| Synonym | Source |
|---|---|
| chlorogenate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| chlorogenate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6097142 | Beilstein |