EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O9 |
| Net Charge | 0 |
| Average Mass | 354.311 |
| Monoisotopic Mass | 354.09508 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| InChIKey | CWVRJTMFETXNAD-JUHZACGLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorogenic acid (CHEBI:16112) has functional parent (−)-quinic acid (CHEBI:17521) |
| chlorogenic acid (CHEBI:16112) has functional parent trans-caffeic acid (CHEBI:16433) |
| chlorogenic acid (CHEBI:16112) has role food component (CHEBI:78295) |
| chlorogenic acid (CHEBI:16112) has role plant metabolite (CHEBI:76924) |
| chlorogenic acid (CHEBI:16112) is a cinnamate ester (CHEBI:36087) |
| chlorogenic acid (CHEBI:16112) is a tannin (CHEBI:26848) |
| chlorogenic acid (CHEBI:16112) is conjugate acid of chlorogenate (CHEBI:57644) |
| Incoming Relation(s) |
| chlorogenate (CHEBI:57644) is conjugate base of chlorogenic acid (CHEBI:16112) |
| IUPAC Name |
|---|
| edit(1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| Chlorogenate | KEGG COMPOUND |
| Chlorogenic acid | KEGG COMPOUND |
| [1S-(1alpha,3beta,4alpha,5alpha)]3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxycyclohexanecarboxylic acid | ChEBI |
| 3-(3,4-Dihydroxycinnamoyl)quinic acid | ChemIDplus |
| 3-Caffeoylquinic acid | ChemIDplus |
| 3-O-Caffeoylquinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00852 | KEGG COMPOUND |
| C00852 | KEGG COMPOUND |
| CAFFEOYLQUINATE | MetaCyc |
| HMDB0003164 | HMDB |
| Chlorogenic_acid | Wikipedia |
| C00002724 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2017157 | Reaxys |
| CAS:327-97-9 | KEGG COMPOUND |
| Citations |
|---|