EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O9 |
| Net Charge | 0 |
| Average Mass | 354.311 |
| Monoisotopic Mass | 354.09508 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| InChIKey | CWVRJTMFETXNAD-JUHZACGLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorogenic acid (CHEBI:16112) has functional parent (−)-quinic acid (CHEBI:17521) |
| chlorogenic acid (CHEBI:16112) has functional parent trans-caffeic acid (CHEBI:16433) |
| chlorogenic acid (CHEBI:16112) has role antineoplastic agent (CHEBI:35610) |
| chlorogenic acid (CHEBI:16112) has role food component (CHEBI:78295) |
| chlorogenic acid (CHEBI:16112) has role plant metabolite (CHEBI:76924) |
| chlorogenic acid (CHEBI:16112) is a cinnamate ester (CHEBI:36087) |
| chlorogenic acid (CHEBI:16112) is a tannin (CHEBI:26848) |
| chlorogenic acid (CHEBI:16112) is conjugate acid of chlorogenate (CHEBI:57644) |
| Incoming Relation(s) |
| chlorogenate (CHEBI:57644) is conjugate base of chlorogenic acid (CHEBI:16112) |
| IUPAC Name |
|---|
| edit(1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| [1S-(1alpha,3beta,4alpha,5alpha)]3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxycyclohexanecarboxylic acid | ChEBI |
| 3-(3,4-Dihydroxycinnamoyl)quinic acid | ChemIDplus |
| 3-Caffeoylquinic acid | ChemIDplus |
| 3-O-Caffeoylquinic acid | ChemIDplus |
| 5-cqa | ChEMBL |
| 5-O-(3,4-Dihydroxycinnamoyl)-L-quinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002724 | KNApSAcK |
| C00852 | KEGG COMPOUND |
| C00852 | KEGG COMPOUND |
| CAFFEOYLQUINATE | MetaCyc |
| Chlorogenic_acid | Wikipedia |
| HMDB0003164 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2017157 | Reaxys |
| CAS:327-97-9 | KEGG COMPOUND |
| Citations |
|---|