EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O6 |
| Net Charge | -1 |
| Average Mass | 191.159 |
| Monoisotopic Mass | 191.05611 |
| SMILES | O=C([O-])[C@]1(O)C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/p-1/t3-,4-,5-,7+/m1/s1 |
| InChIKey | AAWZDTNXLSGCEK-WYWMIBKRSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-quinate (CHEBI:29751) has role plant metabolite (CHEBI:76924) |
| (−)-quinate (CHEBI:29751) is a quinate (CHEBI:26490) |
| (−)-quinate (CHEBI:29751) is conjugate base of (−)-quinic acid (CHEBI:17521) |
| Incoming Relation(s) |
| 3-dehydroquinate (CHEBI:32364) has functional parent (−)-quinate (CHEBI:29751) |
| 4-O-feruloyl-D-quinate (CHEBI:60078) has functional parent (−)-quinate (CHEBI:29751) |
| chlorogenate (CHEBI:57644) has functional parent (−)-quinate (CHEBI:29751) |
| (−)-quinic acid (CHEBI:17521) is conjugate acid of (−)-quinate (CHEBI:29751) |
| IUPAC Names |
|---|
| (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate |
| 1L-1(OH),3,4/5-Tetrahydroxycyclohexanecarboxylate |
| Synonyms | Source |
|---|---|
| (−)-quinate | IUBMB |
| Quinate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| L-quinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00296 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5029142 | Reaxys |