EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | [NH3+]CC(O)CC(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8) |
| InChIKey | YQGDEPYYFWUPGO-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) is a amino-acid zwitterion (CHEBI:35238) |
| γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) is conjugate acid of 4-amino-3-hydroxybutanoate (CHEBI:11955) |
| γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) is tautomer of γ-amino-β-hydroxybutyric acid (CHEBI:16080) |
| Incoming Relation(s) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is conjugate base of γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is tautomer of γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) |
| IUPAC Name |
|---|
| 4-azaniumyl-3-hydroxybutanoate |
| Synonym | Source |
|---|---|
| 4-ammonio-3-hydroxybutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-amino-3-hydroxybutanoate | UniProt |