EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16080 - γ-amino-β-hydroxybutyric acid
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | NCC(O)CC(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8) |
| InChIKey | YQGDEPYYFWUPGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) has functional parent butyric acid (CHEBI:30772) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is a γ-amino acid (CHEBI:33707) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is conjugate acid of 4-amino-3-hydroxybutanoate (CHEBI:11955) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is tautomer of γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) |
| Incoming Relation(s) |
| carnitinium (CHEBI:3424) has functional parent γ-amino-β-hydroxybutyric acid (CHEBI:16080) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is conjugate base of γ-amino-β-hydroxybutyric acid (CHEBI:16080) |
| γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) is tautomer of γ-amino-β-hydroxybutyric acid (CHEBI:16080) |
| IUPAC Name |
|---|
| 4-amino-3-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 3-hydroxy-GABA | ChemIDplus |
| 4-Amino-3-hydroxybutanoic acid | KEGG COMPOUND |
| 4-amino-3-hydroxybutyric acid | ChemIDplus |
| GABOB | KEGG COMPOUND |
| gamma-Amino-beta-hydroxybutyric acid | KEGG COMPOUND |