EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO3 |
| Net Charge | -1 |
| Average Mass | 118.112 |
| Monoisotopic Mass | 118.05097 |
| SMILES | NCC(O)CC(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/p-1 |
| InChIKey | YQGDEPYYFWUPGO-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) has functional parent butyrate (CHEBI:17968) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is a γ-amino acid anion (CHEBI:71666) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is conjugate base of γ-amino-β-hydroxybutyric acid (CHEBI:16080) |
| 4-amino-3-hydroxybutanoate (CHEBI:11955) is conjugate base of γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) |
| Incoming Relation(s) |
| γ-amino-β-hydroxybutyric acid (CHEBI:16080) is conjugate acid of 4-amino-3-hydroxybutanoate (CHEBI:11955) |
| γ-amino-β-hydroxybutyric acid zwitterion (CHEBI:57630) is conjugate acid of 4-amino-3-hydroxybutanoate (CHEBI:11955) |
| Synonym | Source |
|---|---|
| 4-Amino-3-hydroxybutanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03678 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:352-21-6 | KEGG COMPOUND |