EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O6 |
| Net Charge | -1 |
| Average Mass | 369.478 |
| Monoisotopic Mass | 369.22826 |
| SMILES | O=C([O-])CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCCO |
| InChI | InChI=1S/C20H34O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h11-12,15-17,19,21-22,24H,1-10,13-14H2,(H,25,26)/p-1/b12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | LDUBDFDZFOQXGF-HTGUDJHRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) has functional parent prostaglandin E1(1−) (CHEBI:57397) |
| 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) is conjugate base of 20-hydroxyprostaglandin E1 (CHEBI:137526) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is conjugate acid of 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15,20-trihydroxy-9-oxoprost-13-en-1-oate |
| Synonyms | Source |
|---|---|
| 20-hydroxy-PGE1(1−) | ChEBI |
| 20-hydroxy-prostaglandin E1(1−) | ChEBI |
| (11α,13E,15S)-11,15,20-trihydroxy-9-oxoprost-13-en-1-oate | IUPAC |
| UniProt Name | Source |
|---|---|
| 20-hydroxy prostaglandin E1 | UniProt |
| Citations |
|---|