EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H74O17 |
| Net Charge | 0 |
| Average Mass | 911.092 |
| Monoisotopic Mass | 910.49260 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@@]([H])(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CO[C@@]2([H])O[C@H]2CC[C@]3(C)[C@@]4([H])CC=C5[C@]6([H])CC(C)(C)CC[C@]6(C(=O)O)CC[C@@]5(C)[C@]4(C)CC[C@@]3([H])[C@]2(C)C=O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C47H74O17/c1-22-30(50)33(53)35(55)38(60-22)64-37-32(52)26(62-39-36(56)34(54)31(51)25(19-48)61-39)20-59-40(37)63-29-11-12-43(4)27(44(29,5)21-49)10-13-46(7)28(43)9-8-23-24-18-42(2,3)14-16-47(24,41(57)58)17-15-45(23,46)6/h8,21-22,24-40,48,50-56H,9-20H2,1-7H3,(H,57,58)/t22-,24-,25+,26-,27+,28+,29-,30-,31+,32-,33+,34-,35+,36+,37+,38-,39-,40-,43-,44-,45+,46+,47-/m0/s1 |
| InChIKey | SKHHYJVYSRMYHD-YDIXZRNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serjania salzmanniana (IPNI:785156-1) | stem (BTO:0001300) | PubMed (8699187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | molluscicide A substance used to destroy pests of the phylum Mollusca. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salzmannianoside A (CHEBI:66157) has functional parent gypsogenin (CHEBI:5580) |
| salzmannianoside A (CHEBI:66157) has role antifungal agent (CHEBI:35718) |
| salzmannianoside A (CHEBI:66157) has role molluscicide (CHEBI:33904) |
| salzmannianoside A (CHEBI:66157) has role plant metabolite (CHEBI:76924) |
| salzmannianoside A (CHEBI:66157) is a monocarboxylic acid (CHEBI:25384) |
| salzmannianoside A (CHEBI:66157) is a pentacyclic triterpenoid (CHEBI:25872) |
| salzmannianoside A (CHEBI:66157) is a trisaccharide derivative (CHEBI:63571) |
| salzmannianoside A (CHEBI:66157) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3β)-3-{[6-deoxy-α-L-mannopyranosyl-(1→2)-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranosyl]oxy}-23-oxoolean-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| 3-O-{[β-D-glucopyranosyl-(1→4)]-[α-L-rhamnopyranosyl-(1→2)]-α-L-arabinopyranosyl}gypsogenin | ChEBI |
| Citations |
|---|