EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO2 |
| Net Charge | 0 |
| Average Mass | 127.143 |
| Monoisotopic Mass | 127.06333 |
| SMILES | O=C(O)C1=CCCNC1 |
| InChI | InChI=1S/C6H9NO2/c8-6(9)5-2-1-3-7-4-5/h2,7H,1,3-4H2,(H,8,9) |
| InChIKey | QTDZOWFRBNTPQR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Areca catechu (ncbitaxon:184783) | fruit (BTO:0000486) | Article (Phytochemistry, 1998, Vol. 48(3), pp. 581-582.) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guvacine (CHEBI:5576) has role GABA reuptake inhibitor (CHEBI:85384) |
| guvacine (CHEBI:5576) has role plant metabolite (CHEBI:76924) |
| guvacine (CHEBI:5576) is a pyridine alkaloid (CHEBI:26416) |
| guvacine (CHEBI:5576) is a secondary amino compound (CHEBI:50995) |
| guvacine (CHEBI:5576) is a tetrahydropyridine (CHEBI:26921) |
| guvacine (CHEBI:5576) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| guvacine (CHEBI:5576) is a β-amino acid (CHEBI:33706) |
| Incoming Relation(s) |
| guvacoline (CHEBI:80754) has functional parent guvacine (CHEBI:5576) |
| IUPAC Name |
|---|
| 1,2,5,6-tetrahydropyridine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,5,6-tetrahydro-3-pyridinecarboxylic acid | ChEBI |
| 1,2,5,6-tetrahydronicotinic acid | ChemIDplus |
| Citations |
|---|