EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80754 - guvacoline
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | COC(=O)C1=CCCNC1 |
| InChI | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
| InChIKey | DYPLDWLIOGXSSE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Areca catechu (ncbitaxon:184783) | fruit (BTO:0000486) | Article (Phytochemistry, 1998, Vol. 48(3), pp. 581-582.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guvacoline (CHEBI:80754) has functional parent guvacine (CHEBI:5576) |
| guvacoline (CHEBI:80754) has role muscarinic agonist (CHEBI:38325) |
| guvacoline (CHEBI:80754) has role plant metabolite (CHEBI:76924) |
| guvacoline (CHEBI:80754) is a enoate ester (CHEBI:51702) |
| guvacoline (CHEBI:80754) is a methyl ester (CHEBI:25248) |
| guvacoline (CHEBI:80754) is a pyridine alkaloid (CHEBI:26416) |
| guvacoline (CHEBI:80754) is a secondary amino compound (CHEBI:50995) |
| guvacoline (CHEBI:80754) is a tetrahydropyridine (CHEBI:26921) |
| guvacoline (CHEBI:80754) is a α,β-unsaturated carboxylic ester (CHEBI:51737) |
| guvacoline (CHEBI:80754) is a β-amino acid ester (CHEBI:85139) |
| IUPAC Name |
|---|
| methyl 1,2,5,6-tetrahydropyridine-3-carboxylate |
| Synonyms | Source |
|---|---|
| guvacine methyl ester | ChEBI |
| guvacoline | ChEBI |
| methyl 1,2,5,6-tetrahydronicotinate | ChEBI |
| norarecoline | ChEBI |
| Citations |
|---|