EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80754 - guvacoline
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | COC(=O)C1=CCCNC1 |
| InChI | InChI=1S/C7H11NO2/c1-10-7(9)6-3-2-4-8-5-6/h3,8H,2,4-5H2,1H3 |
| InChIKey | DYPLDWLIOGXSSE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Areca catechu (ncbitaxon:184783) | fruit (BTO:0000486) | Article (Phytochemistry, 1998, Vol. 48(3), pp. 581-582.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guvacoline (CHEBI:80754) has functional parent guvacine (CHEBI:5576) |
| guvacoline (CHEBI:80754) has role muscarinic agonist (CHEBI:38325) |
| guvacoline (CHEBI:80754) has role plant metabolite (CHEBI:76924) |
| guvacoline (CHEBI:80754) is a enoate ester (CHEBI:51702) |
| guvacoline (CHEBI:80754) is a methyl ester (CHEBI:25248) |
| guvacoline (CHEBI:80754) is a pyridine alkaloid (CHEBI:26416) |
| guvacoline (CHEBI:80754) is a secondary amino compound (CHEBI:50995) |
| guvacoline (CHEBI:80754) is a tetrahydropyridine (CHEBI:26921) |
| guvacoline (CHEBI:80754) is a α,β-unsaturated carboxylic ester (CHEBI:51737) |
| guvacoline (CHEBI:80754) is a β-amino acid ester (CHEBI:85139) |
| IUPAC Name |
|---|
| methyl 1,2,5,6-tetrahydropyridine-3-carboxylate |
| Synonyms | Source |
|---|---|
| guvacine methyl ester | ChEBI |
| guvacoline | ChEBI |
| methyl 1,2,5,6-tetrahydronicotinate | ChEBI |
| norarecoline | ChEBI |
| Citations |
|---|