EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N3O4S |
| Net Charge | -1 |
| Average Mass | 406.528 |
| Monoisotopic Mass | 406.18060 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)NCCCC)N[C@@H](C(=O)[O-])C(C)(C)S1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-5-11-21-17(25)15(18-23-16(19(26)27)20(2,3)28-18)22-14(24)12-13-9-7-6-8-10-13/h6-10,15-16,18,23H,4-5,11-12H2,1-3H3,(H,21,25)(H,22,24)(H,26,27)/p-1/t15-,16+,18-/m1/s1 |
| InChIKey | QRLSGQYOHPQEPE-SOLBZPMBSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloyl-butylamine(1−) (CHEBI:176775) is a penicillinate anion (CHEBI:51356) |
| benzylpenicilloyl-butylamine(1−) (CHEBI:176775) is conjugate base of benzylpenicilloyl-butylamine (CHEBI:55472) |
| Incoming Relation(s) |
| benzylpenicilloyl-butylamine sodium (CHEBI:176785) has part benzylpenicilloyl-butylamine(1−) (CHEBI:176775) |
| benzylpenicilloyl-butylamine (CHEBI:55472) is conjugate acid of benzylpenicilloyl-butylamine(1−) (CHEBI:176775) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(1R)-2-(butylamino)-2-oxo-1-(2-phenylacetamido)ethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
| Synonyms | Source |
|---|---|
| (2R,4S)-2-{(1R)-2-(butylamino)-2-oxo-1-[(phenylacetyl)amino]ethyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylate | IUPAC |
| BPO-BA(1−) | ChEBI |
| benzylpenicilloyl butylamine(1−) | ChEBI |
| BPO-butylamine(1−) | ChEBI |