EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19) |
| InChIKey | UGAGPNKCDRTDHP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxyhexadecanoic acid (CHEBI:55328) has role plant metabolite (CHEBI:76924) |
| 16-hydroxyhexadecanoic acid (CHEBI:55328) is a hydroxypalmitic acid (CHEBI:72726) |
| 16-hydroxyhexadecanoic acid (CHEBI:55328) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 16-hydroxyhexadecanoic acid (CHEBI:55328) is conjugate acid of 16-hydroxyhexadecanoate (CHEBI:55329) |
| Incoming Relation(s) |
| 16-(β-D-glucopyranosyloxy)hexadecanoic acid (CHEBI:144935) has functional parent 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| 16-hydroxyhexadecanoyl-CoA (CHEBI:85213) has functional parent 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) has functional parent 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| oscr#28 (CHEBI:79150) has functional parent 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| 16-hydroxyhexadecanoate (CHEBI:55329) is conjugate base of 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| IUPAC Name |
|---|
| 16-hydroxyhexadecanoic acid |
| Synonyms | Source |
|---|---|
| 16-Hydroxyhexadecanoic acid | ChemIDplus |
| juniperic acid | ChemIDplus |
| ω-hydroxypalmitic acid | ChemIDplus |
| 16-hydroxy-hexadecanoic acid | LIPID MAPS |
| 16-OH 16:0 | ChEBI |
| 16-hydroxypalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050051 | LIPID MAPS |
| HMDB0006294 | HMDB |
| C18218 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1783998 | Reaxys |
| CAS:506-13-8 | ChemIDplus |
| Citations |
|---|