EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O4 |
| Net Charge | 0 |
| Average Mass | 288.428 |
| Monoisotopic Mass | 288.23006 |
| SMILES | O=C(O)CC(O)CCCCCCCCCCCCCO |
| InChI | InChI=1S/C16H32O4/c17-13-11-9-7-5-3-1-2-4-6-8-10-12-15(18)14-16(19)20/h15,17-18H,1-14H2,(H,19,20) |
| InChIKey | ZGYXOTYZKRXDBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) has functional parent 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) is a 3-hydroxy fatty acid (CHEBI:59845) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) is conjugate acid of 3,16-dihydroxyhexadecanoate (CHEBI:63904) |
| Incoming Relation(s) |
| (3R)-3,16-dihydroxyhexadecanoic acid (CHEBI:79287) is a 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) |
| 3,16-dihydroxyhexadecanoate (CHEBI:63904) is conjugate base of 3,16-dihydroxyhexadecanoic acid (CHEBI:63900) |
| IUPAC Name |
|---|
| 3,16-dihydroxyhexadecanoic acid |
| Synonym | Source |
|---|---|
| 3,16-dihydroxypalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050487 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20870964 | Reaxys |