EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O3 |
| Net Charge | -1 |
| Average Mass | 271.421 |
| Monoisotopic Mass | 271.22787 |
| SMILES | O=C([O-])CCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1 |
| InChIKey | UGAGPNKCDRTDHP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxyhexadecanoate (CHEBI:55329) has functional parent hexadecanoate (CHEBI:7896) |
| 16-hydroxyhexadecanoate (CHEBI:55329) has role plant metabolite (CHEBI:76924) |
| 16-hydroxyhexadecanoate (CHEBI:55329) is a ω-hydroxy-long-chain fatty acid anion (CHEBI:140992) |
| 16-hydroxyhexadecanoate (CHEBI:55329) is conjugate base of 16-hydroxyhexadecanoic acid (CHEBI:55328) |
| Incoming Relation(s) |
| 16-hydroxyhexadecanoic acid (CHEBI:55328) is conjugate acid of 16-hydroxyhexadecanoate (CHEBI:55329) |
| IUPAC Name |
|---|
| 16-hydroxyhexadecanoate |
| Synonym | Source |
|---|---|
| 16-hydroxypalmitate | ChEBI |
| UniProt Name | Source |
|---|---|
| 16-hydroxyhexadecanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7346679 | Reaxys |