EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:546274 - (4-hydroxy-3-nitrophenyl)acetic acid
| Formula | C8H7NO5 |
| Net Charge | 0 |
| Average Mass | 197.146 |
| Monoisotopic Mass | 197.03242 |
| SMILES | O=C(O)Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7NO5/c10-7-2-1-5(4-8(11)12)3-6(7)9(13)14/h1-3,10H,4H2,(H,11,12) |
| InChIKey | QBHBHOSRLDPIHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) has role hapten (CHEBI:59174) |
| (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) is a monocarboxylic acid (CHEBI:25384) |
| (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) is conjugate acid of (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) |
| Incoming Relation(s) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) has functional parent (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) |
| (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) is conjugate base of (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) |
| (4-hydroxy-3-nitrophenyl)acetyl group (CHEBI:53793) is substituent group from (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) |
| IUPAC Name |
|---|
| (4-hydroxy-3-nitrophenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3-nitrophenyl)acetic acid | ChEMBL |
| 2-(4-HYDROXY-3-NITROPHENYL)ACETIC ACID | PDBeChem |
| 4-hydroxy-3-nitrophenylacetic acid | ChEBI |
| NO2HPA | ChEBI |
| Citations |
|---|