EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2O7 |
| Net Charge | 0 |
| Average Mass | 294.219 |
| Monoisotopic Mass | 294.04880 |
| SMILES | O=C(Cc1ccc(O)c([N+](=O)[O-])c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H10N2O7/c15-9-2-1-7(5-8(9)14(19)20)6-12(18)21-13-10(16)3-4-11(13)17/h1-2,5,15H,3-4,6H2 |
| InChIKey | WXEZCVSZMLAVNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) has functional parent (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) has part (4-hydroxy-3-nitrophenyl)acetyl group (CHEBI:53793) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) has role hapten (CHEBI:59174) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) is a N-hydroxysuccinimide ester (CHEBI:53165) |
| 1-((4-hydroxy-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55341) is a 2-nitrophenols (CHEBI:86421) |
| IUPAC Name |
|---|
| 1-[2-(4-hydroxy-3-nitrophenyl)acetoxy]pyrrolidine-2,5-dione |
| Synonyms | Source |
|---|---|
| NP-O-succinimide | ChEBI |
| NP-O-Su | ChEBI |
| 4-hydroxy-3-nitrobenzeneacetic acid, 2,5-dioxo-1-pyrrolidinyl ester | ChEBI |
| 4-hydroxy-3-nitrobenzeneacetic acid 2,5-dioxo-1-pyrrolidinyl ester | ChEBI |
| 1-[[(4-hydroxy-3-nitrophenyl)acetyl]oxy]-2,5-pyrrolidinedione | ChEBI |
| NP-O-succinimide ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15492433 | Reaxys |
| CAS:75679-31-1 | ChemIDplus |
| Citations |
|---|