EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6NO5 |
| Net Charge | -1 |
| Average Mass | 196.138 |
| Monoisotopic Mass | 196.02515 |
| SMILES | O=C([O-])Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7NO5/c10-7-2-1-5(4-8(11)12)3-6(7)9(13)14/h1-3,10H,4H2,(H,11,12)/p-1 |
| InChIKey | QBHBHOSRLDPIHG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) is a monocarboxylic acid anion (CHEBI:35757) |
| (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) is conjugate acid of (3-nitro-4-oxidophenyl)acetate (CHEBI:71332) |
| (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) is conjugate base of (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) |
| Incoming Relation(s) |
| (4-hydroxy-3-nitrophenyl)acetic acid (CHEBI:546274) is conjugate acid of (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) |
| (3-nitro-4-oxidophenyl)acetate (CHEBI:71332) is conjugate base of (4-hydroxy-3-nitrophenyl)acetate (CHEBI:53794) |
| IUPAC Name |
|---|
| (4-hydroxy-3-nitrophenyl)acetate |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3-nitrophenyl)acetate | ChEBI |
| 4-hydroxy-3-nitrophenylacetate | ChEBI |