EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | COc1cc(CC(=O)O)ccc1O |
| InChI | InChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12) |
| InChIKey | QRMZSPFSDQBLIX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homovanillic acid (CHEBI:545959) has functional parent (3,4-dihydroxyphenyl)acetic acid (CHEBI:41941) |
| homovanillic acid (CHEBI:545959) has role human metabolite (CHEBI:77746) |
| homovanillic acid (CHEBI:545959) has role mouse metabolite (CHEBI:75771) |
| homovanillic acid (CHEBI:545959) is a guaiacols (CHEBI:134251) |
| homovanillic acid (CHEBI:545959) is a monocarboxylic acid (CHEBI:25384) |
| homovanillic acid (CHEBI:545959) is conjugate acid of homovanillate (CHEBI:133744) |
| Incoming Relation(s) |
| N-octylhomovanillamide (CHEBI:64041) has functional parent homovanillic acid (CHEBI:545959) |
| homovanillate (CHEBI:133744) is conjugate base of homovanillic acid (CHEBI:545959) |
| IUPAC Name |
|---|
| 2-(4-hydroxy-3-methoxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| Homovanillic acid | KEGG COMPOUND |
| (4-hydroxy-3-methoxyphenyl)acetic acid | IUPAC |
| Vanillacetic acid | ChemIDplus |
| 4-Hydroxy-3-methoxybenzeneacetic acid | ChEBI |
| 3-Methoxy-4-hydroxyphenylacetic acid | ChEBI |
| HVA | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05582 | KEGG COMPOUND |
| CPD-7651 | MetaCyc |
| Homovanillic_acid | Wikipedia |
| HMDB0000118 | HMDB |
| C00029504 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213447 | Reaxys |
| CAS:306-08-1 | KEGG COMPOUND |
| CAS:306-08-1 | ChemIDplus |
| Citations |
|---|