EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO3 |
| Net Charge | 0 |
| Average Mass | 293.407 |
| Monoisotopic Mass | 293.19909 |
| SMILES | CCCCCCCCNC(=O)Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H27NO3/c1-3-4-5-6-7-8-11-18-17(20)13-14-9-10-15(19)16(12-14)21-2/h9-10,12,19H,3-8,11,13H2,1-2H3,(H,18,20) |
| InChIKey | RRCXCIBDXPXSRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-octylhomovanillamide (CHEBI:64041) has functional parent homovanillic acid (CHEBI:545959) |
| N-octylhomovanillamide (CHEBI:64041) has role protective agent (CHEBI:50267) |
| N-octylhomovanillamide (CHEBI:64041) is a guaiacols (CHEBI:134251) |
| N-octylhomovanillamide (CHEBI:64041) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-(4-hydroxy-3-methoxyphenyl)-N-octylacetamide |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3-methoxy-N-octylbenzeneacetamide | ChemIDplus |
| octyl homovanillamide | ChEBI |
| octylhomovanillamide | ChEBI |
| OHV | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6371275 | Reaxys |
| CAS:58418-73-8 | ChemIDplus |
| Citations |
|---|