EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | COc1cc(CC(=O)[O-])ccc1O |
| InChI | InChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)/p-1 |
| InChIKey | QRMZSPFSDQBLIX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homovanillate (CHEBI:133744) has role human metabolite (CHEBI:77746) |
| homovanillate (CHEBI:133744) has role mouse metabolite (CHEBI:75771) |
| homovanillate (CHEBI:133744) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| homovanillate (CHEBI:133744) is conjugate base of homovanillic acid (CHEBI:545959) |
| Incoming Relation(s) |
| homovanillic acid (CHEBI:545959) is conjugate acid of homovanillate (CHEBI:133744) |
| IUPAC Name |
|---|
| (4-hydroxy-3-methoxyphenyl)acetate |
| Synonym | Source |
|---|---|
| 3-methoxy-4-hydroxyphenylacetate | ChEBI |