EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15O7 |
| Net Charge | -1 |
| Average Mass | 343.311 |
| Monoisotopic Mass | 343.08233 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc([O-])cc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3/p-1 |
| InChIKey | CPCPHNWWTJLXKQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5'-O-trimethyltricetin(1−) (CHEBI:60020) is a flavonoid oxoanion (CHEBI:60038) |
| 3',4',5'-O-trimethyltricetin(1−) (CHEBI:60020) is conjugate base of 3',4',5'-O-trimethyltricetin (CHEBI:543745) |
| Incoming Relation(s) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) is conjugate acid of 3',4',5'-O-trimethyltricetin(1−) (CHEBI:60020) |
| IUPAC Name |
|---|
| 5-hydroxy-4-oxo-2-(3,4,5-trimethoxyphenyl)-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| 3',4',5'-O-trimethyltricetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12573 | MetaCyc |