EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | QGXBDMJGAMFCBF-LUJOEAJASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epiandrosterone (CHEBI:541975) has functional parent 5α-androstane (CHEBI:28859) |
| epiandrosterone (CHEBI:541975) has role androgen (CHEBI:50113) |
| epiandrosterone (CHEBI:541975) has role human metabolite (CHEBI:77746) |
| epiandrosterone (CHEBI:541975) is a 17-oxo steroid (CHEBI:19168) |
| epiandrosterone (CHEBI:541975) is a 3β-hydroxy steroid (CHEBI:36836) |
| epiandrosterone (CHEBI:541975) is a androstanoid (CHEBI:50402) |
| Incoming Relation(s) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) has functional parent epiandrosterone (CHEBI:541975) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has functional parent epiandrosterone (CHEBI:541975) |
| epiandrosterone 3-β-D-glucoside (CHEBI:145048) has functional parent epiandrosterone (CHEBI:541975) |
| epiandrosterone sulfate (CHEBI:83040) has functional parent epiandrosterone (CHEBI:541975) |
| IUPAC Name |
|---|
| 3β-hydroxy-5α-androstan-17-one |
| Synonyms | Source |
|---|---|
| 3-Epiandrosterone | ChemIDplus |
| 3β-Hydroxyetioallocholan-17-one | ChemIDplus |
| d-Epiandrosterone | ChemIDplus |
| iso-Androsterone | ChemIDplus |
| Isoandrosterone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5α-androstan-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C07635 | KEGG COMPOUND |
| CPD-13750 | MetaCyc |
| Epiandrosterone | Wikipedia |
| HMDB0000365 | HMDB |
| LMST02020023 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1884007 | Reaxys |
| CAS:481-29-8 | KEGG COMPOUND |
| CAS:481-29-8 | ChemIDplus |
| Citations |
|---|