EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11-14,17,20H,3-10H2,1-2H3/t11-,12+,13+,14+,17+,18+,19+/m1/s1 |
| InChIKey | ONVVZSHYQMOXLN-ZVMDJWLLSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) has functional parent epiandrosterone (CHEBI:541975) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) has role androgen (CHEBI:50113) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) is a 17-oxo steroid (CHEBI:19168) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) is a 3β-hydroxy steroid (CHEBI:36836) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) is a 7-oxo steroid (CHEBI:47789) |
| 3β-hydroxy-5α-androstane-7,17-dione (CHEBI:79834) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β-hydroxy-5α-androstane-7,17-dione |
| Synonyms | Source |
|---|---|
| (3aS,3bR,5aR,7S,9aS,9bS,11aS)-7-hydroxy-9a,11a-dimethyltetradecahydro-1H-cyclopenta[a]phenanthrene-1,4(3bH)-dione | IUPAC |
| (3β,5α)-3-hydroxy-androstane-7,17-dione | ChemIDplus |
| 5α-androstan-3β-ol-7,17-dione | ChEBI |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5α-androstane-7,17-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C15332 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:49643-99-4 | ChemIDplus |