EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O7 |
| Net Charge | 0 |
| Average Mass | 276.245 |
| Monoisotopic Mass | 276.09575 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c11-5(1-3-7(13)14)9(17)12-6(10(18)19)2-4-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | KOSRFJWDECSPRO-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu (CHEBI:5390) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Glu (CHEBI:5390) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Glu-Glu (CHEBI:5390) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| β-citryl-Glu-Glu (CHEBI:90168) has functional parent Glu-Glu (CHEBI:5390) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| H-Glu-Glu-OH | ChEBI |
| H-L-Glu-L-Glu-OH | ChEBI |
| L-Glu-L-Glu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01425 | KEGG COMPOUND |
| HMDB0028818 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729673 | Reaxys |
| CAS:3929-61-1 | KEGG COMPOUND |
| CAS:3929-61-1 | ChemIDplus |