EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN6O3 |
| Net Charge | 0 |
| Average Mass | 388.815 |
| Monoisotopic Mass | 388.10507 |
| SMILES | CN1CCN(C(=O)O[C@@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | GBBSUAFBMRNDJC-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-zopiclone (CHEBI:53762) is a zopiclone (CHEBI:32315) |
| (5R)-zopiclone (CHEBI:53762) is enantiomer of eszopiclone (CHEBI:53760) |
| Incoming Relation(s) |
| eszopiclone (CHEBI:53760) is enantiomer of (5R)-zopiclone (CHEBI:53762) |
| IUPAC Name |
|---|
| (5R)-6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate |
| INN | Source |
|---|---|
| zopiclone | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB01198 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10709343 | Beilstein |