EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN6O3 |
| Net Charge | 0 |
| Average Mass | 388.815 |
| Monoisotopic Mass | 388.10507 |
| SMILES | CN1CCN(C(=O)O[C@@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | GBBSUAFBMRNDJC-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-zopiclone (CHEBI:53762) is a zopiclone (CHEBI:32315) |
| (5R)-zopiclone (CHEBI:53762) is enantiomer of eszopiclone (CHEBI:53760) |
| Incoming Relation(s) |
| eszopiclone (CHEBI:53760) is enantiomer of (5R)-zopiclone (CHEBI:53762) |
| IUPAC Name |
|---|
| (5R)-6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate |
| INN | Source |
|---|---|
| zopiclone | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB01198 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10709343 | Beilstein |