EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN6O3 |
| Net Charge | 0 |
| Average Mass | 388.815 |
| Monoisotopic Mass | 388.10507 |
| SMILES | CN1CCN(C(=O)OC2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | GBBSUAFBMRNDJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zopiclone (CHEBI:32315) has role antidepressant (CHEBI:35469) |
| zopiclone (CHEBI:32315) has role antipsychotic agent (CHEBI:35476) |
| zopiclone (CHEBI:32315) has role anxiolytic drug (CHEBI:35474) |
| zopiclone (CHEBI:32315) has role central nervous system depressant (CHEBI:35488) |
| zopiclone (CHEBI:32315) has role sedative (CHEBI:35717) |
| zopiclone (CHEBI:32315) is a monochloropyridine (CHEBI:39172) |
| zopiclone (CHEBI:32315) is a pyrrolopyrazine (CHEBI:48337) |
| Incoming Relation(s) |
| (5R)-zopiclone (CHEBI:53762) is a zopiclone (CHEBI:32315) |
| eszopiclone (CHEBI:53760) is a zopiclone (CHEBI:32315) |
| IUPAC Name |
|---|
| 6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate |
| INNs | Source |
|---|---|
| zopiclona | WHO MedNet |
| zopiclone | WHO MedNet |
| zopiclone | WHO MedNet |
| zopiclonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-(5-chloro-2-pyridinyl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methyl-1-piperazinecarboxylate | NIST Chemistry WebBook |
| NSC-758463 | ChEMBL |
| RP-27267 | ChEMBL |
| (±)-zopiclone | DrugBank |
| Brand Names | Source |
|---|---|
| Amoban | KEGG DRUG |
| Imovane | DrugCentral |
| Zileze 3.75 | ChEMBL |
| Zileze 7.5 | ChEMBL |
| Zimovane | DrugCentral |
| Zimovane ls | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:768704 | Beilstein |
| CAS:43200-80-2 | DrugBank |
| CAS:43200-80-2 | KEGG DRUG |
| CAS:43200-80-2 | ChemIDplus |
| Citations |
|---|