EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN6O3 |
| Net Charge | 0 |
| Average Mass | 388.815 |
| Monoisotopic Mass | 388.10507 |
| SMILES | CN1CCN(C(=O)O[C@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3/t16-/m0/s1 |
| InChIKey | GBBSUAFBMRNDJC-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eszopiclone (CHEBI:53760) has role central nervous system depressant (CHEBI:35488) |
| eszopiclone (CHEBI:53760) has role sedative (CHEBI:35717) |
| eszopiclone (CHEBI:53760) is a zopiclone (CHEBI:32315) |
| eszopiclone (CHEBI:53760) is enantiomer of (5R)-zopiclone (CHEBI:53762) |
| Incoming Relation(s) |
| (5R)-zopiclone (CHEBI:53762) is enantiomer of eszopiclone (CHEBI:53760) |
| IUPAC Name |
|---|
| (5S)-6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate |
| INN | Source |
|---|---|
| eszopiclone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (+)-(5S)-6-(5-Chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo(3,4-b)pyrazin-5-yl 4-methylpiperazine-1-carboxylate | ChemIDplus |
| Esopiclone | DrugBank |
| (S)-Zopiclone | ChemIDplus |
| (+)-Zopiclone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1068 | DrugCentral |
| D02624 | KEGG DRUG |
| DB00402 | DrugBank |
| Eszopiclone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8794636 | Beilstein |
| CAS:138729-47-2 | KEGG DRUG |
| CAS:138729-47-2 | ChemIDplus |