EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN6O3 |
| Net Charge | 0 |
| Average Mass | 388.815 |
| Monoisotopic Mass | 388.10507 |
| SMILES | CN1CCN(C(=O)O[C@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClN6O3/c1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h2-5,10,16H,6-9H2,1H3/t16-/m0/s1 |
| InChIKey | GBBSUAFBMRNDJC-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eszopiclone (CHEBI:53760) has role anxiolytic drug (CHEBI:35474) |
| eszopiclone (CHEBI:53760) has role central nervous system depressant (CHEBI:35488) |
| eszopiclone (CHEBI:53760) has role sedative (CHEBI:35717) |
| eszopiclone (CHEBI:53760) is a zopiclone (CHEBI:32315) |
| eszopiclone (CHEBI:53760) is enantiomer of (5R)-zopiclone (CHEBI:53762) |
| Incoming Relation(s) |
| (5R)-zopiclone (CHEBI:53762) is enantiomer of eszopiclone (CHEBI:53760) |
| IUPAC Name |
|---|
| (5S)-6-(5-chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate |
| INNs | Source |
|---|---|
| eszopiclona | WHO MedNet |
| eszopiclone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (+)-(5S)-6-(5-Chloropyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo(3,4-b)pyrazin-5-yl 4-methylpiperazine-1-carboxylate | ChemIDplus |
| Esopiclone | DrugBank |
| Estorra | ChEMBL |
| Eszopiclon | ChEMBL |
| Eszopiclone civ | ChEMBL |
| GSK-1755165 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1068 | DrugCentral |
| D02624 | KEGG DRUG |
| DB00402 | DrugBank |
| Eszopiclone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8794636 | Beilstein |
| CAS:138729-47-2 | ChemIDplus |
| CAS:138729-47-2 | KEGG DRUG |
| Citations |
|---|