EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N4O5S |
| Net Charge | 0 |
| Average Mass | 472.567 |
| Monoisotopic Mass | 472.17804 |
| SMILES | [H][C@@]1([C@H](NC(=O)[C@H](N)c2ccc(O)cc2)C(=O)NCc2ccccc2)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C23H28N4O5S/c1-23(2)18(22(31)32)27-21(33-23)17(20(30)25-12-13-6-4-3-5-7-13)26-19(29)16(24)14-8-10-15(28)11-9-14/h3-11,16-18,21,27-28H,12,24H2,1-2H3,(H,25,30)(H,26,29)(H,31,32)/t16-,17-,18+,21-/m1/s1 |
| InChIKey | LIPVPDPMVISMIH-DCXXXQMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicilloyl-benzylamine (CHEBI:55440) has part amoxicilloyl group (CHEBI:53705) |
| amoxicilloyl-benzylamine (CHEBI:55440) is a monocarboxylic acid amide (CHEBI:29347) |
| amoxicilloyl-benzylamine (CHEBI:55440) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(1R)-1-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-(benzylamino)-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| AXO-BA | ChEBI |
| Citations |
|---|