EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N6O5S2 |
| Net Charge | 0 |
| Average Mass | 462.513 |
| Monoisotopic Mass | 462.07801 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H18N6O5S2/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29)/t11-,13-,16-/m1/s1 |
| InChIKey | OLVCFLKTBJRLHI-AXAPSJFSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefamandole (CHEBI:3480) has role antibacterial drug (CHEBI:36047) |
| cefamandole (CHEBI:3480) is a cephalosporin (CHEBI:23066) |
| cefamandole (CHEBI:3480) is a semisynthetic derivative (CHEBI:72588) |
| cefamandole (CHEBI:3480) is conjugate acid of cefamandole(1−) (CHEBI:53652) |
| Incoming Relation(s) |
| O-formylcefamandole (CHEBI:53654) has functional parent cefamandole (CHEBI:3480) |
| cefamandole(1−) (CHEBI:53652) is conjugate base of cefamandole (CHEBI:3480) |
| IUPAC Name |
|---|
| 7β-[(2R)-2-hydroxy-2-phenylacetamido]-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefamandol | ChemIDplus |
| cefamandole | KEGG DRUG |
| céfamandole | WHO MedNet |
| cefamandolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-hydroxy-2-phenylacetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| (6R,7R)-7-(R)-Mandelamido-3-(((1-methyl-1H-tetrazol-5-yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-carboxylic acid | ChemIDplus |
| Cefadole | ChemIDplus |
| Cephadole | ChemIDplus |
| Cephamandole | ChemIDplus |
| L-Cefamandole | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406309 | Beilstein |
| CAS:34444-01-4 | DrugBank |
| CAS:34444-01-4 | KEGG COMPOUND |
| CAS:34444-01-4 | KEGG DRUG |
| CAS:34444-01-4 | ChemIDplus |
| Citations |
|---|