EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O4 |
| Net Charge | 0 |
| Average Mass | 286.327 |
| Monoisotopic Mass | 286.12051 |
| SMILES | Oc1ccc([C@H]2C[C@@H](c3ccc(O)cc3)[C@H](O)CO2)cc1 |
| InChI | InChI=1S/C17H18O4/c18-13-5-1-11(2-6-13)15-9-17(21-10-16(15)20)12-3-7-14(19)8-4-12/h1-8,15-20H,9-10H2/t15-,16+,17+/m0/s1 |
| InChIKey | JQRWWSPNQHLXDY-GVDBMIGSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sugiresinol (CHEBI:53645) has functional parent agatharesinol (CHEBI:53627) |
| sugiresinol (CHEBI:53645) is a norlignan (CHEBI:53629) |
| Incoming Relation(s) |
| hydroxysugiresinol (CHEBI:53646) has functional parent sugiresinol (CHEBI:53645) |
| IUPAC Name |
|---|
| (1R)-1,5-anhydro-2,3-dideoxy-1,3-bis(4-hydroxyphenyl)-D-threo-pentitol |
| Synonyms | Source |
|---|---|
| sequirin A | ChEBI |
| (−)-sugiresinol | ChEBI |
| (3S)-tetrahydro-4α,6α-bis(4-hydroxyphenyl)-2H-pyran-3-ol | ChEBI |
| sequirin-A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:33909 | Reaxys |
| Citations |
|---|