EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | Oc1ccc([C@H]2C[C@@H](c3ccc(O)c(O)c3)[C@H](O)CO2)cc1 |
| InChI | InChI=1S/C17H18O5/c18-12-4-1-10(2-5-12)17-8-13(16(21)9-22-17)11-3-6-14(19)15(20)7-11/h1-7,13,16-21H,8-9H2/t13-,16+,17+/m0/s1 |
| InChIKey | KTBMETYOQLNVNV-IAOVAPTHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxysugiresinol (CHEBI:53646) has functional parent sugiresinol (CHEBI:53645) |
| hydroxysugiresinol (CHEBI:53646) is a norlignan (CHEBI:53629) |
| IUPAC Name |
|---|
| (1R)-1,5-anhydro-2,3-dideoxy-3-(3,4-dihydroxyphenyl)-1-(4-hydroxyphenyl)-D-threo-pentitol |
| Synonyms | Source |
|---|---|
| sequirin B | ChEBI |
| 4-[(2R)-3,4,5,6-tetrahydro-5alpha-hydroxy-2-(4-hydroxyphenyl)-2H-pyran-4beta-yl]-1,2-benzenediol | ChEBI |
| sequirin-B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7272673 | Reaxys |
| Citations |
|---|