EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O4 |
| Net Charge | 0 |
| Average Mass | 286.327 |
| Monoisotopic Mass | 286.12051 |
| SMILES | OC[C@@H](O)[C@@H](/C=C/c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18O4/c18-11-17(21)16(13-4-8-15(20)9-5-13)10-3-12-1-6-14(19)7-2-12/h1-10,16-21H,11H2/b10-3+/t16-,17+/m0/s1 |
| InChIKey | DVUXXXYVVWRAIA-UDEVJOAWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agatharesinol (CHEBI:53627) is a norlignan (CHEBI:53629) |
| Incoming Relation(s) |
| sequirin C (CHEBI:53644) has functional parent agatharesinol (CHEBI:53627) |
| sugiresinol (CHEBI:53645) has functional parent agatharesinol (CHEBI:53627) |
| IUPAC Name |
|---|
| (2S,3S,4E)-3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2336768 | Reaxys |
| Citations |
|---|