EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | OC[C@@H](O)[C@@H](/C=C/c1ccc(O)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H18O5/c18-10-17(22)14(12-4-8-15(20)16(21)9-12)7-3-11-1-5-13(19)6-2-11/h1-9,14,17-22H,10H2/b7-3+/t14-,17+/m0/s1 |
| InChIKey | UWWISKPOVFKUES-SITIDLGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sequirin C (CHEBI:53644) has functional parent agatharesinol (CHEBI:53627) |
| sequirin C (CHEBI:53644) has role metabolite (CHEBI:25212) |
| sequirin C (CHEBI:53644) is a norlignan (CHEBI:53629) |
| IUPAC Name |
|---|
| 4-[(1S,2E)-1-[(1S)-1,2-dihydroxyethyl]-3-(4-hydroxyphenyl)prop-2-en-1-yl]benzene-1,2-diol |
| Synonym | Source |
|---|---|
| sequirin-C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7354895 | Reaxys |
| Citations |
|---|