EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O2 |
| Net Charge | 0 |
| Average Mass | 76.095 |
| Monoisotopic Mass | 76.05243 |
| SMILES | CC(O)CO |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
| InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propane-1,2-diol (CHEBI:16997) has role allergen (CHEBI:50904) |
| propane-1,2-diol (CHEBI:16997) has role human xenobiotic metabolite (CHEBI:76967) |
| propane-1,2-diol (CHEBI:16997) has role mouse metabolite (CHEBI:75771) |
| propane-1,2-diol (CHEBI:16997) has role protic solvent (CHEBI:48356) |
| propane-1,2-diol (CHEBI:16997) is a glycol (CHEBI:13643) |
| propane-1,2-diol (CHEBI:16997) is a propane-1,2-diols (CHEBI:26284) |
| Incoming Relation(s) |
| 2-hydroxypropyl dihydrogen phosphate (CHEBI:18025) has functional parent propane-1,2-diol (CHEBI:16997) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has functional parent propane-1,2-diol (CHEBI:16997) |
| (R)-propane-1,2-diol (CHEBI:28972) is a propane-1,2-diol (CHEBI:16997) |
| (S)-propane-1,2-diol (CHEBI:29002) is a propane-1,2-diol (CHEBI:16997) |
| IUPAC Name |
|---|
| propane-1,2-diol |
| Synonyms | Source |
|---|---|
| Propane-1,2-diol | KEGG COMPOUND |
| 1,2-Propanediol | KEGG COMPOUND |
| Propylene glycol | KEGG COMPOUND |
| 1,2-Propylenglykol | ChemIDplus |
| α-propyleneglycol | ChemIDplus |
| 1,2-dihydroxypropane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| propane-1,2-diol | UniProt |
| Citations |
|---|