EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO2Se |
| Net Charge | -1 |
| Average Mass | 181.073 |
| Monoisotopic Mass | 181.97257 |
| SMILES | C[Se]C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/p-1/t3-/m0/s1 |
| InChIKey | XDSSPSLGNGIIHP-VKHMYHEASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methyl-L-selenocysteinate (CHEBI:53126) is a Se-methylselenocysteinate (CHEBI:53128) |
| Se-methyl-L-selenocysteinate (CHEBI:53126) is conjugate base of Se-methyl-L-selenocysteine (CHEBI:27812) |
| Se-methyl-L-selenocysteinate (CHEBI:53126) is enantiomer of Se-methyl-D-selenocysteinate (CHEBI:53129) |
| Incoming Relation(s) |
| Se-methyl-L-selenocysteine (CHEBI:27812) is conjugate acid of Se-methyl-L-selenocysteinate (CHEBI:53126) |
| Se-methyl-D-selenocysteinate (CHEBI:53129) is enantiomer of Se-methyl-L-selenocysteinate (CHEBI:53126) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(methylselanyl)propanoate |