EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N3O4S |
| Net Charge | 0 |
| Average Mass | 269.282 |
| Monoisotopic Mass | 269.04703 |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NO)cc2)no1 |
| InChI | InChI=1S/C10H11N3O4S/c1-7-6-10(12-17-7)13-18(15,16)9-4-2-8(11-14)3-5-9/h2-6,11,14H,1H3,(H,12,13) |
| InChIKey | MJAMPGKHIZXVFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) has functional parent sulfamethoxazole (CHEBI:9332) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) has functional parent sulfanilamide (CHEBI:45373) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) has role allergen (CHEBI:50904) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) has role metabolite (CHEBI:25212) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) is a isoxazoles (CHEBI:55373) |
| sulfamethoxazole hydroxylamine (CHEBI:53016) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-(hydroxyamino)-N-(5-methylisoxazol-3-yl)benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-(Hydroxyamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide | ChemIDplus |
| Smx-HA | ChemIDplus |
| SMX-NHOH | ChEBI |
| Sulfamethoxazole hydroxylamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6336217 | Reaxys |
| CAS:114438-33-4 | ChemIDplus |
| Citations |
|---|