EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@]1(C(C)C)C=CC(=C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | LFJQCDVYDGGFCH-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-β-phellandrene (CHEBI:53) has role plant metabolite (CHEBI:76924) |
| (+)-β-phellandrene (CHEBI:53) is a β-phellandrene (CHEBI:48741) |
| (+)-β-phellandrene (CHEBI:53) is enantiomer of (−)-β-phellandrene (CHEBI:129) |
| Incoming Relation(s) |
| (−)-β-phellandrene (CHEBI:129) is enantiomer of (+)-β-phellandrene (CHEBI:53) |
| IUPAC Names |
|---|
| (4S)-p-mentha-1(7),2-diene |
| (6S)-3-methylidene-6-(propan-2-yl)cyclohex-1-ene |
| Synonyms | Source |
|---|---|
| (+)-beta-Phellandrene | KEGG COMPOUND |
| (+)-p-mentha-1(7),2-diene | IUPAC |
| (S)-3-isopropyl-6-methylenecyclohexene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00003052 | KNApSAcK |
| C09877 | KEGG COMPOUND |
| CPD-8769 | MetaCyc |
| HMDB0041634 | HMDB |
| LMPR0102090022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3194593 | Reaxys |
| CAS:6153-16-8 | KEGG COMPOUND |