EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C1C=CC(C(C)C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3 |
| InChIKey | LFJQCDVYDGGFCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-phellandrene (CHEBI:48741) has role plant metabolite (CHEBI:76924) |
| β-phellandrene (CHEBI:48741) is a phellandrene (CHEBI:50034) |
| Incoming Relation(s) |
| (+)-β-phellandrene (CHEBI:53) is a β-phellandrene (CHEBI:48741) |
| (−)-β-phellandrene (CHEBI:129) is a β-phellandrene (CHEBI:48741) |
| IUPAC Names |
|---|
| 3-methylidene-6-(propan-2-yl)cyclohex-1-ene |
| p-mentha-1(7),2-diene |
| Synonyms | Source |
|---|---|
| 2-p-menthadiene | ChemIDplus |
| 3-methylene-6-(1-methylethyl)cyclohexene | ChemIDplus |
| 4-isopropyl-1-methylene-2-cyclohexene | ChemIDplus |
| 3-isopropyl-6-methylene-1-cyclohexene | NIST Chemistry WebBook |
| β-Phellandren | ChEBI |
| beta-phellandrene | ChEMBL |
| UniProt Name | Source |
|---|---|
| β-phellandrene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Beta-phellandrene | MetaCyc |
| HMDB0036081 | HMDB |
| Citations |
|---|