EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | [H][C@@]1(C(C)C)C=CC(=C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | LFJQCDVYDGGFCH-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-phellandrene (CHEBI:129) has role plant metabolite (CHEBI:76924) |
| (−)-β-phellandrene (CHEBI:129) is a β-phellandrene (CHEBI:48741) |
| (−)-β-phellandrene (CHEBI:129) is enantiomer of (+)-β-phellandrene (CHEBI:53) |
| Incoming Relation(s) |
| (+)-β-phellandrene (CHEBI:53) is enantiomer of (−)-β-phellandrene (CHEBI:129) |
| IUPAC Names |
|---|
| (4R)-p-mentha-1(7),2-diene |
| (6R)-3-methylidene-6-(propan-2-yl)cyclohex-1-ene |
| Synonyms | Source |
|---|---|
| (3R)-3-isopropyl-6-methylenecyclohexene | IUPAC |
| (−)-3-methylene-6-(1-methylethyl)cyclohexene | ChemIDplus |
| (-)-beta-Phellandrene | KEGG COMPOUND |
| (−)-p-mentha-1(7),2-diene | ChEBI |
| (R)-3-isopropyl-6-methylenecyclohexene | ChEBI |
| β-phellandrene l-form | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-β-phellandrene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010873 | KNApSAcK |
| C11392 | KEGG COMPOUND |
| CPD-8768 | MetaCyc |
| HMDB0041633 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3194594 | Beilstein |
| CAS:6153-17-9 | KEGG COMPOUND |
| CAS:6153-17-9 | ChemIDplus |